| Product Name | 1,2-Dichlorobutane |
| CAS No. | 616-21-7 |
| Synonyms | Butane, 1,2-dichloro-; HSDB 5717; NSC 93880 |
| InChI | InChI=1/C4H8Cl2/c1-2-4(6)3-5/h4H,2-3H2,1H3 |
| Molecular Formula | C4H8Cl2 |
| Molecular Weight | 127.0123 |
| Density | 1.079g/cm3 |
| Boiling point | 122.8°C at 760 mmHg |
| Flash point | 27.4°C |
| Refractive index | 1.427 |
| Risk Codes | R10:Flammable.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
616-21-7 1,2-dichlorobutane
service@apichina.com
- Next:616-23-9 2,3-dichloropropan-1-ol
- Previous:616-20-6 3-chloropentane