| Product Name | 1,2-Dibromo-5-hexene |
| CAS No. | 4285-48-7 |
| Synonyms | 5,6-dibromohex-1-ene |
| InChI | InChI=1/C6H10Br2/c1-2-3-4-6(8)5-7/h2,6H,1,3-5H2 |
| Molecular Formula | C6H10Br2 |
| Molecular Weight | 241.9516 |
| Density | 1.619g/cm3 |
| Boiling point | 228.8°C at 760 mmHg |
| Flash point | 98.3°C |
| Refractive index | 1.514 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4285-48-7 1,2-dibromo-5-hexene
service@apichina.com