| Product Name | 1,2-Dibenzoylethane |
| CAS No. | 495-71-6 |
| Synonyms | 1,2-Dibenzoylethane,(1,4-Diphenyl-1,4-butanedione); 1,4-Diphenyl-1,4-butanedione; 1,4-diphenylbutane-1,4-dione; 1,4-diphenyl-1,4-butadione |
| InChI | InChI=1/C16H14O2/c17-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.2812 |
| Density | 1.116g/cm3 |
| Boiling point | 407.2°C at 760 mmHg |
| Flash point | 152.5°C |
| Refractive index | 1.574 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
495-71-6 1,2-dibenzoylethane
service@apichina.com
- Next:495-73-8 benquinox
- Previous:495-70-5 meprylcaine