| Product Name | 1,2-Dianilinoethane |
| CAS No. | 150-61-8 |
| Synonyms | N,N-Diphenylethylenediamine; Wanzlicks; 1,2-Dianilinoethane, Pract.; N,N-ethylenedianiline; NN-Diphenylethylenediamine; 1,2-Diphenyl Ethanediamine; N,N'-diphenylethane-1,2-diamine; N,N'-diphenylethane-1,2-diaminium |
| InChI | InChI=1/C14H16N2/c15-11-12-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,15H2 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.2902 |
| Density | 1.093g/cm3 |
| Melting point | 64-67℃ |
| Boiling point | 351.529°C at 760 mmHg |
| Flash point | 148.617°C |
| Refractive index | 1.623 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
150-61-8 1,2-dianilinoethane
service@apichina.com
- Next:150-69-6 4-ethoxyphenylurea
- Previous:150-60-7 dibenzyl disulfide