| Product Name | 1,2-Cyclohexanedione |
| CAS No. | 765-87-7 |
| Synonyms | 1,2-Dioxocyclohexane; 4-07-00-01982 (Beilstein Handbook Reference); AI3-25042; BRN 0507419; CCRIS 6296; NSC 32950; cyclohexane-1,2-dione |
| InChI | InChI=1/C12H18O3/c1-3-7-11-9(5-1)13-12(15-11)8-4-2-6-10(12)14-11/h9-10H,1-8H2 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.2695 |
| Melting point | 35-38℃ |
| Water solubility | soluble |
| Refractive index | 1.546 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
765-87-7 1,2-cyclohexanedione
service@apichina.com