| Product Name | 1-(2-Cyanoethyl)-4-methylpiperazine |
| CAS No. | 4491-92-3 |
| Synonyms | 3-(4-Methylpiperazino)propionitrile; 3-(4-methylpiperazin-1-yl)propanenitrile |
| InChI | InChI=1/C8H15N3/c1-10-5-7-11(8-6-10)4-2-3-9/h2,4-8H2,1H3 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.2248 |
| Density | 0.981g/cm3 |
| Boiling point | 273°C at 760 mmHg |
| Flash point | 113.6°C |
| Refractive index | 1.477 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
4491-92-3 1-(2-cyanoethyl)-4-methylpiperazine
service@apichina.com