| Product Name | 1-(2-Cyanoethyl)-3-(trifluoromethyl)pyrid-2(1H)-one |
| CAS No. | 175277-60-8 |
| Synonyms | 3-[2-Oxo-3-(trifluoromethyl)-1,2-dihydropyridin-1-yl]propanenitrile; 1-(2-Cyanoethyl)-3-(trifluoromethyl)-2(1H)-pyridone; [(2,4-difluorophenyl)sulfanyl]acetonitrile |
| InChI | InChI=1/C8H5F2NS/c9-6-1-2-8(7(10)5-6)12-4-3-11/h1-2,5H,4H2 |
| Molecular Formula | C8H5F2NS |
| Molecular Weight | 185.1938 |
| Density | 1.31g/cm3 |
| Melting point | 88-89℃ |
| Boiling point | 242.4°C at 760 mmHg |
| Flash point | 100.4°C |
| Refractive index | 1.542 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
175277-60-8 1-(2-cyanoethyl)-3-(trifluoromethyl)pyrid-2(1h)-one
service@apichina.com