| Product Name | 1-(2-Chloroethyl)-4-methoxybenzene |
| CAS No. | 18217-00-0 |
| Synonyms | 4-Methoxyphenethyl chloride; 4-(2-chloroethyl)phenyl methyl ether; 2-(4)-Methoxyphenylethylchloride; 4-(2-Chloroethyl)anisole |
| InChI | InChI=1/C9H11ClO/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5H,6-7H2,1H3 |
| Molecular Formula | C9H11ClO |
| Molecular Weight | 170.636 |
| Density | 1.082g/cm3 |
| Boiling point | 249.1°C at 760 mmHg |
| Flash point | 108.7°C |
| Refractive index | 1.512 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37:Irritating to eyes and respiratory system.; R40:Possible risks of irreversible effects.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
18217-00-0 1-(2-chloroethyl)-4-methoxybenzene
service@apichina.com