| Product Name | 1-(2-chloroethyl)-4-fluorobenzene |
| CAS No. | 332-43-4 |
| Synonyms | 4-Fluorophenethyl chloride~2-(4-Fluorophenyl)ethyl chloride |
| InChI | InChI=1/C8H8ClF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
| Molecular Formula | C8H8ClF |
| Molecular Weight | 158.6005 |
| Density | 1.15g/cm3 |
| Boiling point | 204.6°C at 760 mmHg |
| Flash point | 79.9°C |
| Refractive index | 1.501 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
332-43-4 1-(2-chloroethyl)-4-fluorobenzene
service@apichina.com