| Product Name | 1-(2-chloro-6-fluorobenzyl)piperazine |
| CAS No. | 215655-20-2 |
| InChI | InChI=1/C11H14ClFN2/c12-10-2-1-3-11(13)9(10)8-15-6-4-14-5-7-15/h1-3,14H,4-8H2 |
| Molecular Formula | C11H14ClFN2 |
| Molecular Weight | 228.6937 |
| Density | 1.216g/cm3 |
| Boiling point | 299.7°C at 760 mmHg |
| Flash point | 135°C |
| Refractive index | 1.544 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
215655-20-2 1-(2-chloro-6-fluorobenzyl)piperazine
service@apichina.com