| Product Name | 1,2-Butanediol |
| CAS No. | 584-03-2;26171-83-5 |
| Synonyms | .+/-.-1,2-Butanediol; 1,2-Butanediol, (.+/-.)-; Butane-1,2-diol; Butanediol, 1,2-; 1,2-Dihydroxybutane; 4-01-00-02507 (Beilstein Handbook Reference); AI3-07554; BRN 0969169; HSDB 1507; NSC 24242; alpha-Butylene glycol; alpha-Butyleneglycol; (2S)-butane-1,2-diol |
| InChI | InChI=1/C4H10O2/c1-2-4(6)3-5/h4-6H,2-3H2,1H3 |
| Molecular Formula | C4H10O2 |
| Molecular Weight | 90.121 |
| Density | 1.001g/cm3 |
| Melting point | -50℃ |
| Boiling point | 190.3°C at 760 mmHg |
| Flash point | 93.3°C |
| Refractive index | 1.437 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
584-03-2;26171-83-5 1,2-butanediol
service@apichina.com
- Next:584-04-3 1,3-dimercaptopropan-2-ol
- Previous:584-02-1 3-pentanol