| Product Name | 1-(2-bromo-4,6-difluorophenoxy)-2-chloroethane |
| CAS No. | 175203-19-7 |
| Synonyms | 1-Bromo-2-(2-chloroethoxy)-3,5-difluorobenzene |
| InChI | InChI=1/C8H6BrClF2O/c9-6-3-5(11)4-7(12)8(6)13-2-1-10/h3-4H,1-2H2 |
| Molecular Formula | C8H6BrClF2O |
| Molecular Weight | 271.4864 |
| Density | 1.636g/cm3 |
| Boiling point | 282.9°C at 760 mmHg |
| Flash point | 124.9°C |
| Refractive index | 1.515 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175203-19-7 1-(2-bromo-4,6-difluorophenoxy)-2-chloroethane
service@apichina.com