| Product Name | 1,2-Bis(2-pyridyl)ethylene |
| CAS No. | 1437-15-6 |
| Synonyms | 1,2-Di(2-pyridyl)ethylene; 2,2'-ethene-1,2-diyldipyridine; 2,2'-(E)-ethene-1,2-diyldipyridine |
| InChI | InChI=1/C12H10N2/c1-3-9-13-11(5-1)7-8-12-6-2-4-10-14-12/h1-10H/b8-7+ |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.2212 |
| Density | 1.145g/cm3 |
| Melting point | 118-119℃ |
| Boiling point | 346.6°C at 760 mmHg |
| Flash point | 118.9°C |
| Refractive index | 1.675 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1437-15-6 1,2-bis(2-pyridyl)ethylene
service@apichina.com