| Product Name | 1,2-benzodiphenylene sulfide |
| CAS No. | 239-35-0 |
| Synonyms | 11-thiabenzo(a)fluorene; 1,2-benzo-9-thiafluorene; naphtho(1,2:2,3)thionaphthen; benzo[b]naphtho[2,1-d]thiophene |
| InChI | InChI=1/C16H10S/c1-2-6-12-11(5-1)9-10-14-13-7-3-4-8-15(13)17-16(12)14/h1-10H |
| Molecular Formula | C16H10S |
| Molecular Weight | 234.3156 |
| Density | 1.292g/cm3 |
| Melting point | 188-190℃ |
| Boiling point | 434.3°C at 760 mmHg |
| Flash point | 163°C |
| Refractive index | 1.809 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
239-35-0 1,2-benzodiphenylene sulfide
service@apichina.com