| Product Name | 1,2-Benzenedicarboxylic acid, nonyl undecyl ester, branched and linear |
| CAS No. | 111381-91-0 |
| Synonyms | nonyl undecyl phthalate, branched and linear; 3-ethyl-4-methylhexyl 2-propyloctyl benzene-1,2-dicarboxylate; nonyl undecyl benzene-1,2-dicarboxylate |
| InChI | InChI=1/C28H46O4/c1-3-5-7-9-11-12-14-16-20-24-32-28(30)26-22-18-17-21-25(26)27(29)31-23-19-15-13-10-8-6-4-2/h17-18,21-22H,3-16,19-20,23-24H2,1-2H3 |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.6624 |
| Density | 0.966g/cm3 |
| Boiling point | 454.2°C at 760 mmHg |
| Flash point | 243.7°C |
| Refractive index | 1.487 |
111381-91-0 1,2-benzenedicarboxylic acid, nonyl undecyl ester, branched and linear
service@apichina.com