| Product Name | 1,2-Benzenedicarboxylic acid, heptyl undecyl ester, branched and linear |
| CAS No. | 111381-90-9 |
| Synonyms | DI(HEPTYL-UNDECYL)PHTHALATE; heptyl undecyl phthalate, branched and linear; 3-ethylpentyl 2-propyloctyl benzene-1,2-dicarboxylate; heptyl undecyl benzene-1,2-dicarboxylate |
| InChI | InChI=1/C26H42O4/c1-3-5-7-9-10-11-12-14-18-22-30-26(28)24-20-16-15-19-23(24)25(27)29-21-17-13-8-6-4-2/h15-16,19-20H,3-14,17-18,21-22H2,1-2H3 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.6093 |
| Density | 0.975g/cm3 |
| Boiling point | 435.5°C at 760 mmHg |
| Flash point | 233.1°C |
| Refractive index | 1.489 |
111381-90-9 1,2-benzenedicarboxylic acid, heptyl undecyl ester, branched and linear
service@apichina.com