| Product Name | 1,2-Benzenedicarboxylic acid, heptyl nonyl ester, branched and linear |
| CAS No. | 111381-89-6 |
| Synonyms | DI(HEPTYL,NONYL)PHTHALATE; HEPTYL NONYL 1,2-BENZENEDICARBOXYLATE, BRANCHED AND LINEAR); heptyl nonyl phthalate, branched and linear; 3-ethylpentyl 2-propylhexyl benzene-1,2-dicarboxylate; heptyl nonyl benzene-1,2-dicarboxylate |
| InChI | InChI=1/C24H38O4/c1-3-5-7-9-10-12-16-20-28-24(26)22-18-14-13-17-21(22)23(25)27-19-15-11-8-6-4-2/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.5561 |
| Density | 0.985g/cm3 |
| Boiling point | 416.4°C at 760 mmHg |
| Flash point | 222.3°C |
| Refractive index | 1.49 |
111381-89-6 1,2-benzenedicarboxylic acid, heptyl nonyl ester, branched and linear
service@apichina.com