| Product Name | 1,2-Benzenedicarboxylic acid, dihexyl ester, branched and linear |
| CAS No. | 68515-50-4 |
| Synonyms | Branched and linear dihexyl phthalate; bis(4-methylpentyl) benzene-1,2-dicarboxylate |
| InChI | InChI=1/C20H30O4/c1-15(2)9-7-13-23-19(21)17-11-5-6-12-18(17)20(22)24-14-8-10-16(3)4/h5-6,11-12,15-16H,7-10,13-14H2,1-4H3 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.4498 |
| Density | 1.01g/cm3 |
| Boiling point | 341.5°C at 760 mmHg |
| Flash point | 180°C |
| Refractive index | 1.492 |
68515-50-4 1,2-benzenedicarboxylic acid, dihexyl ester, branched and linear
service@apichina.com