| Product Name | 1,2-Benzanthracene |
| CAS No. | 56-55-3 |
| Synonyms | 1,2-benzanthrene; 2,3-benzophenanthracene; 2,3-benzophenanthrene; B(A)A; benz[a]anthracene; Benz[a]anthracene; Benzanthracene; benzanthrene; Benzo[a]anthracene; Benzo[b]phenanthrene; naphthanthracene; tetraphene |
| InChI | InChI=1/C18H12/c1-2-7-15-12-18-16(11-14(15)6-1)10-9-13-5-3-4-8-17(13)18/h1-12H |
| Molecular Formula | C18H12 |
| Molecular Weight | 228.2879 |
| Density | 1.19g/cm3 |
| Melting point | 158-161℃ |
| Boiling point | 436.7°C at 760 mmHg |
| Flash point | 209.1°C |
| Water solubility | 0.0000014 g/100 mL |
| Refractive index | 1.771 |
| Hazard Symbols |  T:Toxic;  N:Dangerous for the environment; |
| Risk Codes | R45:May cause cancer.; R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S53:Avoid exposure - obtain special instructions before use.; S60:This material and its container must be disposed of as hazardous waste.; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
56-55-3 1,2-benzanthracene
service@apichina.com