| Product Name | 1,2,7,8-Diepoxyoctane |
| CAS No. | 2426-07-5 |
| Synonyms | Octadienediepoxide; 1,7-Octadiene diepoxide; 1,2,7,8-Dipoxyoctane, >97%; 2,2'-butane-1,4-diyldioxirane; (2R,2'S)-2,2'-butane-1,4-diyldioxirane; (2S,2'S)-2,2'-butane-1,4-diyldioxirane |
| InChI | InChI=1/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2/t7-,8-/m0/s1 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.1956 |
| Density | 1.051g/cm3 |
| Boiling point | 240°C at 760 mmHg |
| Flash point | 97.8°C |
| Refractive index | 1.477 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R22:Harmful if swallowed.; R24:Toxic in contact with skin.; R40:Possible risks of irreversible effects.; |
| Safety | S28A:After contact with skin, wash immediately with plenty of water.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
2426-07-5 1,2,7,8-diepoxyoctane
service@apichina.com