| Product Name | 1-(2,6-Dimethoxyphenyl)piperazine |
| CAS No. | 148583-59-9 |
| InChI | InChI=1/C12H18N2O2/c1-15-10-4-3-5-11(16-2)12(10)14-8-6-13-7-9-14/h3-5,13H,6-9H2,1-2H3 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.2835 |
| Density | 1.08g/cm3 |
| Boiling point | 375.4°C at 760 mmHg |
| Flash point | 180.8°C |
| Refractive index | 1.526 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
148583-59-9 1-(2,6-dimethoxyphenyl)piperazine
service@apichina.com