| Product Name | 1-(2,5-dichloro-4-nitrophenyl)-2,5-dimethyl-1H-pyrrole |
| CAS No. | 302901-02-6 |
| InChI | InChI=1/C12H10Cl2N2O2/c1-7-3-4-8(2)15(7)11-5-10(14)12(16(17)18)6-9(11)13/h3-6H,1-2H3 |
| Molecular Formula | C12H10Cl2N2O2 |
| Molecular Weight | 285.126 |
| Density | 1.41g/cm3 |
| Melting point | 82℃ |
| Boiling point | 410.6°C at 760 mmHg |
| Flash point | 202.1°C |
| Refractive index | 1.623 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
302901-02-6 1-(2,5-dichloro-4-nitrophenyl)-2,5-dimethyl-1h-pyrrole
service@apichina.com