| Product Name | 1,2,4-Trimethylbenzene |
| CAS No. | 95-63-6 |
| Synonyms | Pseudocumene; 1,2,4-Trimethylbenzere; 1,3,4-Trimethylbenzene |
| InChI | InChI=1/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 |
| Density | 0.88 |
| Melting point | -44℃ |
| Boiling point | 168℃ |
| Flash point | 48℃ |
| Refractive index | 1.503-1.505 |
| Hazard Symbols |  Xn:Harmful;  N:Dangerous for the environment; |
| Risk Codes | R10:Flammable.; R20:Harmful by inhalation.; R36/37/38:Irritating to eyes, respiratory system and skin.; R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
95-63-6 1,2,4-trimethylbenzene
service@apichina.com