| Product Name | [1,2,4]Triazolo[4,3-a]pyridine-3-thiol |
| CAS No. | 6952-68-7 |
| Synonyms | (1,2,4)Triazolo(4,3-a)pyridine-3(2H)-thione; NSC 70716 |
| InChI | InChI=1/C6H5N3S/c10-6-8-7-5-3-1-2-4-9(5)6/h1-4H,(H,8,10) |
| Molecular Formula | C6H5N3S |
| Molecular Weight | 151.189 |
| Density | 1.49g/cm3 |
| Boiling point | 235.1°C at 760 mmHg |
| Flash point | 96°C |
| Refractive index | 1.784 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
6952-68-7 [1,2,4]triazolo[4,3-a]pyridine-3-thiol
service@apichina.com