| Product Name | 1-(2,4-Dichlorophenyl)-1-propanone |
| CAS No. | 37885-41-9 |
| Synonyms | 2,4-Dichloropropiophenone; 2',4'-DICHLOROPROPIOPHENONE |
| InChI | InChI=1/C9H8Cl2O/c1-2-9(12)7-4-3-6(10)5-8(7)11/h3-5H,2H2,1H3 |
| Molecular Formula | C9H8Cl2O |
| Molecular Weight | 203.06 |
| Density | 1.287 |
| Refractive index | 1.551-1.553 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
37885-41-9 1-(2,4-dichlorophenyl)-1-propanone
service@apichina.com