| Product Name | 1-(2,4-Dichlorophenyl)-1-cyclopropyl cyanide |
| CAS No. | 71463-55-3 |
| Synonyms | 1-(2,4-Dichlorophenyl)cyclopropanecarbonitrile |
| InChI | InChI=1/C10H7Cl2N/c11-7-1-2-8(9(12)5-7)10(6-13)3-4-10/h1-2,5H,3-4H2 |
| Molecular Formula | C10H7Cl2N |
| Molecular Weight | 212.0753 |
| Density | 1.38g/cm3 |
| Melting point | 81-85℃ |
| Boiling point | 337.4°C at 760 mmHg |
| Flash point | 149.5°C |
| Refractive index | 1.604 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
71463-55-3 1-(2,4-dichlorophenyl)-1-cyclopropyl cyanide
service@apichina.com