| Product Name | 1,2,4-Benzenetricarboxylic acid, ester with 1,2-ethanediol |
| CAS No. | 71342-70-6 |
| Synonyms | Ethylene glycol and trimellitic anhydride ester; Ethylene glycol trimellitate; Trimellitic anhydride, ethylene glycol reaction product; benzene-1,2,4-tricarboxylic acid - ethane-1,2-diol (1:1) |
| InChI | InChI=1/C9H6O6.C2H6O2/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15;3-1-2-4/h1-3H,(H,10,11)(H,12,13)(H,14,15);3-4H,1-2H2 |
| Molecular Formula | C11H12O8 |
| Molecular Weight | 272.2082 |
| Boiling point | 505.5°C at 760 mmHg |
| Flash point | 273.6°C |
71342-70-6 1,2,4-benzenetricarboxylic acid, ester with 1,2-ethanediol
service@apichina.com