| Product Name | 1,2,3-Trimethylbenzene |
| CAS No. | 526-73-8 |
| Synonyms | hemimellitene |
| InChI | InChI=1/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 |
| Density | 0.894 |
| Melting point | -25℃ |
| Boiling point | 175-176℃ |
| Flash point | 53℃ |
| Refractive index | 1.513 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R10:; R37:; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
526-73-8 1,2,3-trimethylbenzene
service@apichina.com