| Product Name | 1,2,3-benzothiadiazole-5-carbonyl chloride |
| CAS No. | 321309-32-4 |
| InChI | InChI=1/C7H3ClN2OS/c8-7(11)4-1-2-6-5(3-4)9-10-12-6/h1-3H |
| Molecular Formula | C7H3ClN2OS |
| Molecular Weight | 198.6295 |
| Density | 1.577g/cm3 |
| Melting point | 94℃ |
| Boiling point | 311°C at 760 mmHg |
| Flash point | 141.9°C |
| Refractive index | 1.704 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
321309-32-4 1,2,3-benzothiadiazole-5-carbonyl chloride
service@apichina.com