| Product Name | 1,2,3,4-tetrahydro-6-quinolinecarboxylic acid |
| CAS No. | 5382-49-0 |
| Synonyms | 1,2,3,4-tetrahydroquinoline-6-carboxylic acid |
| InChI | InChI=1/C10H11NO2/c12-10(13)8-3-4-9-7(6-8)2-1-5-11-9/h3-4,6,11H,1-2,5H2,(H,12,13) |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.1998 |
| Density | 1.223g/cm3 |
| Boiling point | 382.6°C at 760 mmHg |
| Flash point | 185.2°C |
| Refractive index | 1.587 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
5382-49-0 1,2,3,4-tetrahydro-6-quinolinecarboxylic acid
service@apichina.com