| Product Name | 1,2,3,4-Dibenzanthracene |
| CAS No. | 215-58-7 |
| Synonyms | Dibenz[a,c]anthracene; dibenz(a,c)anthracene; 1,2:3,4-dibenzanthracene; Benztriphenylene; 2,3-Benztriphenylene; benzo[f]tetraphene |
| InChI | InChI=1/C22H14/c1-2-8-16-14-22-20-12-6-4-10-18(20)17-9-3-5-11-19(17)21(22)13-15(16)7-1/h1-14H |
| Molecular Formula | C22H14 |
| Molecular Weight | 278.3466 |
| Density | 1.232g/cm3 |
| Melting point | 202-207℃ |
| Boiling point | 518°C at 760 mmHg |
| Flash point | 264.5°C |
| Refractive index | 1.811 |
| Hazard Symbols | |
| Risk Codes | R40:Possible risks of irreversible effects.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
215-58-7 1,2,3,4-dibenzanthracene
service@apichina.com