| Product Name | 1,15-Pentadecanedioic acid |
| CAS No. | 1460-18-0 |
| Synonyms | Pentadecanedioic acid |
| InChI | InChI=1/C15H28O4/c16-14(17)12-10-8-6-4-2-1-3-5-7-9-11-13-15(18)19/h1-13H2,(H,16,17)(H,18,19) |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.3804 |
| Density | 1.026g/cm3 |
| Melting point | 113-114℃ |
| Boiling point | 445.8°C at 760 mmHg |
| Flash point | 237.5°C |
| Refractive index | 1.474 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1460-18-0 1,15-pentadecanedioic acid
service@apichina.com