| Product Name | 1,1-Dimethylcyclohexane |
| CAS No. | 590-66-9 |
| Synonyms | AI3-28793; NSC 74156; gem-Dimethylcyclohexane; Cyclohexane, 1,1-dimethyl- |
| InChI | InChI=1/C8H16/c1-8(2)6-4-3-5-7-8/h3-7H2,1-2H3 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.21 |
| Density | 0.77 |
| Boiling point | 118-120℃ |
| Flash point | 7℃ |
| Refractive index | 1.428-1.423 |
| Hazard Symbols |  F:Highly flammable;  Xi:Irritant; |
| Risk Codes | R11:Highly flammable.; R38:Irritating to skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S23:Do not inhale gas/fumes/vapour/spray.; S37:Wear suitable gloves.; S9:Keep container in a well-ventilated place.; |
590-66-9 1,1-dimethylcyclohexane
service@apichina.com