| Product Name | 1,1,3,3-Tetrachloropropene |
| CAS No. | 18611-43-3 |
| Synonyms | 1,1,3,3-tetrachloroprop-1-ene |
| InChI | InChI=1/C3H2Cl4/c4-2(5)1-3(6)7/h1-2H |
| Molecular Formula | C3H2Cl4 |
| Molecular Weight | 179.86 |
| Density | 1.532g/cm3 |
| Boiling point | 176.1°C at 760 mmHg |
| Flash point | 64°C |
| Refractive index | 1.511 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
18611-43-3 1,1,3,3-tetrachloropropene
service@apichina.com