| Product Name | (±)-trans-Azetidine-2,4-dicarboxylic acid |
| CAS No. | 121050-03-1 |
| Synonyms | (2R,4R)-azetidinium-2,4-dicarboxylate |
| InChI | InChI=1/C5H7NO4/c7-4(8)2-1-3(6-2)5(9)10/h2-3,6H,1H2,(H,7,8)(H,9,10)/p-1/t2-,3-/m1/s1 |
| Molecular Formula | C5H6NO4 |
| Molecular Weight | 144.106 |
| Boiling point | 352.5°C at 760 mmHg |
| Flash point | 167°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
121050-03-1 (±)-trans-azetidine-2,4-dicarboxylic acid
service@apichina.com
- Next:64854-99-5 candletoxin a
- Previous:64854-98-4 candletoxin b