| Product Name | (±)-1-Aminoindane-1,5-dicarboxylic acid |
| CAS No. | 168560-79-0 |
| Synonyms | AIDA; ()-1-Aminoindan-1,5-dicarboxylic acid; 1-amino-2,3-dihydro-1H-indene-1,5-dicarboxylic acid; (1R)-1-ammonio-2,3-dihydro-1H-indene-1,5-dicarboxylate; (1S)-1-ammonio-2,3-dihydro-1H-indene-1,5-dicarboxylate |
| InChI | InChI=1/C11H11NO4/c12-11(10(15)16)4-3-6-5-7(9(13)14)1-2-8(6)11/h1-2,5H,3-4,12H2,(H,13,14)(H,15,16)/p-1/t11-/m0/s1 |
| Molecular Formula | C11H10NO4 |
| Molecular Weight | 220.2019 |
| Boiling point | 470.4°C at 760 mmHg |
| Flash point | 238.3°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
168560-79-0 (±)-1-aminoindane-1,5-dicarboxylic acid
service@apichina.com