| Density |
1.222 g/cm3 |
Boiling point |
487.6ºC at 760 mmHg |
| Melting point |
|
Refractive index |
1.565 |
| Flash point |
248.7ºC |
Optical Activity |
|
| Water solubility |
10 mM in DMSO |
Physical State |
|
| Purity |
|
Appearance |
|
| InChI |
InChI=1S/C12H16N2O3/c1-8(13)11(15)14-10(12(16)17)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3,(H,14,15)(H,16,17) |
| InChIKey |
InChIKey=OMNVYXHOSHNURL-UHFFFAOYSA-N |
| Synonyms |
L-ALA-PHE; L-ALANYL-L-PHENYLALANINE; H-ALA-PHE-OH; ALA-PHE; alanylphenylalanine; L-alanyl-phenylalanine; (S)-2-[[(S)-2-Aminopropionyl]amino]-3-phenylpropionic acid; Ala-Phe-OH |
| SMILES |
SMILES
C(C(NC(C(C)N)=O)C(O)=O)C1=CC=CC=C1
Canonical SMILES
O=C(O)C(NC(=O)C(N)C)CC=1C=CC=CC1 |
Solubility data |
|
Alanyl dipeptides such as ala-leu, ala-lys, ala-gly, ala-pro, ala-tyr and ala-phe may be used in physicochemical studies or to evaluate dipeptide separation technologies. Alanyl dipeptides may also be used for studying cell uptake mechanisms, dipeptide metabolism or cell growth supplementation benefits.
