Density |
1.144±0.06 g/cm3(Predicted) |
Boiling point |
501.2±50.0 °C(Predicted) |
Melting point |
>249°C (dec.) |
Refractive index |
|
Flash point |
|
Optical Activity |
|
Water solubility |
|
Physical State |
|
Purity |
|
Appearance |
|
InChI |
InChI=1S/C15H22N2O3/c1-3-10(2)13(16)14(18)17-12(15(19)20)9-11-7-5-4-6-8-11/h4-8,10,12-13H,3,9,16H2,1-2H3,(H,17,18)(H,19,20)/t10-,12-,13-/m0/s1 |
InChIKey |
InChIKey=WMDZARSFSMZOQO-DRZSPHRISA-N |
Synonyms |
Isoleucyl-Phenylalanine; L-Ile-L-Phe; L-Phenylalanine,L-isoleucyl- |
SMILES |
O=C(O)C(NC(=O)C(N)C(C)CC)CC=1C=CC=CC1 |
Solubility data |
|
Isoleucyl-Phenylalanine is a dipeptide derived from the incomplete breakdown of protein digestion or protein catabolism. It has not yet been identified in human tissues or biofluids and so it is classified as an ′Expected′ metabolite.